C17H23ClN2O2 — CID 70565949
4-chloro-N-[(3R,4R)-1-cyclohexyl-4-hydroxypyrrolidin-3-yl]benzamide (PubChem CID 70565949) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4R)-1-cyclohexyl-4-hydroxypyrrolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(3R,4R)-1-cyclohexyl-4-hydroxypyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 70565949 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-chloro-N-[(3R,4R)-1-cyclohexyl-4-hydroxypyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CN(C2CCCCC2)C[C@H]1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-13-8-6-12(7-9-13)17(22)19-15-10-20(11-16(15)21)14-4-2-1-3-5-14/h6-9,14-16,21H,1-5,10-11H2,(H,19,22)/t15-,16-/m1/s1 |
| InChIKey | ACHSYSANXCYONU-HZPDHXFCSA-N |
| XLogP | 2.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |