C22H28N2O3 — CID 70566061
cyclopentanamine;1-cyclopentyl-4-oxo-6-phenylpyridine-3-carboxylic acid (PubChem CID 70566061) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is cyclopentanamine;1-cyclopentyl-4-oxo-6-phenylpyridine-3-carboxylic acid.
| Compound Name | cyclopentanamine;1-cyclopentyl-4-oxo-6-phenylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70566061 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | cyclopentanamine;1-cyclopentyl-4-oxo-6-phenylpyridine-3-carboxylic acid |
| SMILES | NC1CCCC1.O=C(O)c1cn(C2CCCC2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C17H17NO3.C5H11N/c19-16-10-15(12-6-2-1-3-7-12)18(11-14(16)17(20)21)13-8-4-5-9-13;6-5-3-1-2-4-5/h1-3,6-7,10-11,13H,4-5,8-9H2,(H,20,21);5H,1-4,6H2 |
| InChIKey | BBFJIAKVWJRJRB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |