About adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid
adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid (PubChem CID 70567947) has the molecular formula C32H40N2O3
and a molecular weight of 500.68 g/mol. Its IUPAC name is adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid |
| PubChem CID | 70567947 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid |
| SMILES | NC12CC3CC(CC(C3)C1)C2.O=C(O)c1cn(C23CC4CC(CC(C4)C2)C3)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C22H23NO3.C10H17N/c24-20-9-19(17-4-2-1-3-5-17)23(13-18(20)21(25)26)22-10-14-6-15(11-22)8-16(7-14)12-22;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h1-5,9,13-16H,6-8,10-12H2,(H,25,26);7-9H,1-6,11H2 |
| InChIKey | AOGWQWCDZBARBT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The IUPAC name of adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid (CID 70567947) is adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid.
What is the SMILES notation for adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The canonical SMILES for adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid is NC12CC3CC(CC(C3)C1)C2.O=C(O)c1cn(C23CC4CC(CC(C4)C2)C3)c(-c2ccccc2)cc1=O.
What is the InChIKey of adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The InChIKey is AOGWQWCDZBARBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO3.C10H17N/c24-20-9-19(17-4-2-1-3-5-17)23(13-18(20)21(25)26)22-10-14-6-15(11-22)8-16(7-14)12-22;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h1-5,9,13-16H,6-8,10-12H2,(H,25,26);7-9H,1-6,11H2.
What are the key properties of adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid has a molecular weight of 500.68 g/mol, XLogP of 6.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-1-amine;1-(1-adamantyl)-4-oxo-6-phenylpyridine-3-carboxylic acid is sourced from PubChem (CID 70567947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).