C17H13ClF3NO3 — CID 70567304
4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(1-hydroxypropan-2-yloxy)benzonitrile (PubChem CID 70567304) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(1-hydroxypropan-2-yloxy)benzonitrile.
| Compound Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(1-hydroxypropan-2-yloxy)benzonitrile |
|---|---|
| PubChem CID | 70567304 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(1-hydroxypropan-2-yloxy)benzonitrile |
| SMILES | CC(CO)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1C#N |
| InChI | InChI=1S/C17H13ClF3NO3/c1-10(9-23)24-16-7-13(4-2-11(16)8-22)25-15-5-3-12(6-14(15)18)17(19,20)21/h2-7,10,23H,9H2,1H3 |
| InChIKey | PCPNVWDMVHRZEH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |