C15H20O5 — CID 7056874
(3R)-3-(3-methoxyphenyl)-2,2-dimethylhexanedioic acid (PubChem CID 7056874) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3R)-3-(3-methoxyphenyl)-2,2-dimethylhexanedioic acid.
| Compound Name | (3R)-3-(3-methoxyphenyl)-2,2-dimethylhexanedioic acid |
|---|---|
| PubChem CID | 7056874 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3R)-3-(3-methoxyphenyl)-2,2-dimethylhexanedioic acid |
| SMILES | COc1cccc([C@@H](CCC(=O)O)C(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C15H20O5/c1-15(2,14(18)19)12(7-8-13(16)17)10-5-4-6-11(9-10)20-3/h4-6,9,12H,7-8H2,1-3H3,(H,16,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | BBKCGTNYGGOIPK-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |