C22H20N4O6 — CID 70569034
7-methoxy-N-[(5-nitrofuran-2-yl)methylideneamino]-4-oxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8-tetraene-3-carboxamide (PubChem CID 70569034) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is 7-methoxy-N-[(5-nitrofuran-2-yl)methylideneamino]-4-oxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8-tetraene-3-carboxamide.
| Compound Name | 7-methoxy-N-[(5-nitrofuran-2-yl)methylideneamino]-4-oxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 70569034 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 7-methoxy-N-[(5-nitrofuran-2-yl)methylideneamino]-4-oxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8-tetraene-3-carboxamide |
| SMILES | COc1cc2c3c(c1)c(=O)c(C(=O)NN=Cc1ccc([N+](=O)[O-])o1)cn3C1CCCCC21 |
| InChI | InChI=1S/C22H20N4O6/c1-31-13-8-15-14-4-2-3-5-18(14)25-11-17(21(27)16(9-13)20(15)25)22(28)24-23-10-12-6-7-19(32-12)26(29)30/h6-11,14,18H,2-5H2,1H3,(H,24,28) |
| InChIKey | JSVXTNQFCYDRLH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|