C24H42O3 — CID 70572176
5-tert-butyl-3-ethyl-2,2-dimethylnonane;4-hydroxybenzoic acid (PubChem CID 70572176) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 5-tert-butyl-3-ethyl-2,2-dimethylnonane;4-hydroxybenzoic acid.
| Compound Name | 5-tert-butyl-3-ethyl-2,2-dimethylnonane;4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70572176 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 5-tert-butyl-3-ethyl-2,2-dimethylnonane;4-hydroxybenzoic acid |
| SMILES | CCCCC(CC(CC)C(C)(C)C)C(C)(C)C.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H36.C7H6O3/c1-9-11-12-15(17(6,7)8)13-14(10-2)16(3,4)5;8-6-3-1-5(2-4-6)7(9)10/h14-15H,9-13H2,1-8H3;1-4,8H,(H,9,10) |
| InChIKey | ZSGHYORUELXTHC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |