C18H17N5O9S3 — CID 70574009
5-[2-[[(6R,7S)-2-carboxy-7-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-oxoethyl]-3-oxo-1,2-oxazole-4-carboxylic acid (PubChem CID 70574009) has the molecular formula C18H17N5O9S3 and a molecular weight of 543.56 g/mol. Its IUPAC name is 5-[2-[[(6R,7S)-2-carboxy-7-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-oxoethyl]-3-oxo-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-[2-[[(6R,7S)-2-carboxy-7-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-oxoethyl]-3-oxo-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70574009 |
| Molecular Formula | C18H17N5O9S3 |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | 5-[2-[[(6R,7S)-2-carboxy-7-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-oxoethyl]-3-oxo-1,2-oxazole-4-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)Cc2o[nH]c(=O)c2C(=O)O)C(=O)N2C(C(=O)O)=C(CSc3nnc(C)s3)CS[C@@H]21 |
| InChI | InChI=1S/C18H17N5O9S3/c1-6-20-21-17(35-6)34-5-7-4-33-16-18(31-2,15(30)23(16)11(7)14(28)29)19-9(24)3-8-10(13(26)27)12(25)22-32-8/h16H,3-5H2,1-2H3,(H,19,24)(H,22,25)(H,26,27)(H,28,29)/t16-,18+/m1/s1 |
| InChIKey | MVPDDHCJBVPBPG-AEFFLSMTSA-N |
| XLogP | -0.13 |
| TPSA | 205.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|