C18H24F3NO4 — CID 70574193
(2S)-2-[(3-butoxy-4,4,4-trifluoro-2-methylbutanoyl)amino]-3-phenylpropanoic acid (PubChem CID 70574193) has the molecular formula C18H24F3NO4 and a molecular weight of 375.39 g/mol. Its IUPAC name is (2S)-2-[(3-butoxy-4,4,4-trifluoro-2-methylbutanoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3-butoxy-4,4,4-trifluoro-2-methylbutanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70574193 |
| Molecular Formula | C18H24F3NO4 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2S)-2-[(3-butoxy-4,4,4-trifluoro-2-methylbutanoyl)amino]-3-phenylpropanoic acid |
| SMILES | CCCCOC(C(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO4/c1-3-4-10-26-15(18(19,20)21)12(2)16(23)22-14(17(24)25)11-13-8-6-5-7-9-13/h5-9,12,14-15H,3-4,10-11H2,1-2H3,(H,22,23)(H,24,25)/t12?,14-,15?/m0/s1 |
| InChIKey | HUPAZHNZXCWRDF-BLZCZZARSA-N |
| XLogP | 3.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|