About 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate
3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate (PubChem CID 70574581) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate.
Molecular Properties
| Compound Name | 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate |
| PubChem CID | 70574581 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate |
| SMILES | CC(Oc1ccccc1)(Oc1ccccn1)C(=O)OCC=CN |
| InChI | InChI=1S/C17H18N2O4/c1-17(16(20)21-13-7-11-18,22-14-8-3-2-4-9-14)23-15-10-5-6-12-19-15/h2-12H,13,18H2,1H3 |
| InChIKey | UDACAWADGSNFJK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate?
The IUPAC name of 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate (CID 70574581) is 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate.
What is the SMILES notation for 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate?
The canonical SMILES for 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate is CC(Oc1ccccc1)(Oc1ccccn1)C(=O)OCC=CN.
What is the InChIKey of 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate?
The InChIKey is UDACAWADGSNFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-17(16(20)21-13-7-11-18,22-14-8-3-2-4-9-14)23-15-10-5-6-12-19-15/h2-12H,13,18H2,1H3.
What are the key properties of 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate?
3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate has a molecular weight of 314.34 g/mol, XLogP of 2.27, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoprop-2-enyl 2-phenoxy-2-pyridin-2-yloxypropanoate is sourced from PubChem (CID 70574581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).