C23H27N3O4S — CID 70574848
2-[4-[amino(phenyl)methoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid (PubChem CID 70574848) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[4-[amino(phenyl)methoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid.
| Compound Name | 2-[4-[amino(phenyl)methoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid |
|---|---|
| PubChem CID | 70574848 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[4-[amino(phenyl)methoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid |
| SMILES | NC(OC(=O)C1NC(CC(=O)O)SC12CCN(c1ccccc1)CC2)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O4S/c24-21(16-7-3-1-4-8-16)30-22(29)20-23(31-18(25-20)15-19(27)28)11-13-26(14-12-23)17-9-5-2-6-10-17/h1-10,18,20-21,25H,11-15,24H2,(H,27,28) |
| InChIKey | XTWBXEZPTPUNEU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|