C17H22BrNO2 — CID 70575002
2-[[1-(3-bromophenyl)-2-methylpropyl]amino]hept-1-ene-3,5-dione (PubChem CID 70575002) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)-2-methylpropyl]amino]hept-1-ene-3,5-dione.
| Compound Name | 2-[[1-(3-bromophenyl)-2-methylpropyl]amino]hept-1-ene-3,5-dione |
|---|---|
| PubChem CID | 70575002 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[[1-(3-bromophenyl)-2-methylpropyl]amino]hept-1-ene-3,5-dione |
| SMILES | C=C(NC(c1cccc(Br)c1)C(C)C)C(=O)CC(=O)CC |
| InChI | InChI=1S/C17H22BrNO2/c1-5-15(20)10-16(21)12(4)19-17(11(2)3)13-7-6-8-14(18)9-13/h6-9,11,17,19H,4-5,10H2,1-3H3 |
| InChIKey | IGBWEBVAAROQPO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|