C18H16N2O5S — CID 70577340
3-acetyl-4-hydroxy-6-methyl-2-oxo-N-phenyl-1H-quinoline-7-sulfonamide (PubChem CID 70577340) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-6-methyl-2-oxo-N-phenyl-1H-quinoline-7-sulfonamide.
| Compound Name | 3-acetyl-4-hydroxy-6-methyl-2-oxo-N-phenyl-1H-quinoline-7-sulfonamide |
|---|---|
| PubChem CID | 70577340 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-acetyl-4-hydroxy-6-methyl-2-oxo-N-phenyl-1H-quinoline-7-sulfonamide |
| SMILES | CC(=O)c1c(O)c2cc(C)c(S(=O)(=O)Nc3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C18H16N2O5S/c1-10-8-13-14(19-18(23)16(11(2)21)17(13)22)9-15(10)26(24,25)20-12-6-4-3-5-7-12/h3-9,20H,1-2H3,(H2,19,22,23) |
| InChIKey | SDQKPHPJZWMSEC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |