C16H12F3N3O4S2 — CID 167306382
7-methyl-2,3-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306382) has the molecular formula C16H12F3N3O4S2 and a molecular weight of 431.42 g/mol. Its IUPAC name is 7-methyl-2,3-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | 7-methyl-2,3-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306382 |
| Molecular Formula | C16H12F3N3O4S2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 7-methyl-2,3-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3N3O4S2/c1-8-6-11-12(21-15(24)14(23)20-11)7-13(8)28(25,26)22-9-2-4-10(5-3-9)27-16(17,18)19/h2-7,22H,1H3,(H,20,23)(H,21,24) |
| InChIKey | LFDNDJZZMQINHS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|