C21H19N3O4S2 — CID 167306341
N-(3,5-dimethyl-4-thiophen-2-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 167306341) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-(3,5-dimethyl-4-thiophen-2-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-(3,5-dimethyl-4-thiophen-2-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 167306341 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-(3,5-dimethyl-4-thiophen-2-ylphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)Nc1cc(C)c(-c2cccs2)c(C)c1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-11-9-15-16(23-21(26)20(25)22-15)10-18(11)30(27,28)24-14-7-12(2)19(13(3)8-14)17-5-4-6-29-17/h4-10,24H,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | KKXIXJVJGXRPRD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|