C11H14N4O5 — CID 7057747
4-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyltriazolo[4,5-b]pyridin-5-one (PubChem CID 7057747) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyltriazolo[4,5-b]pyridin-5-one.
| Compound Name | 4-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyltriazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 7057747 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyltriazolo[4,5-b]pyridin-5-one |
| SMILES | Cn1nnc2c1ccc(=O)n2[C@H]1O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14N4O5/c1-14-5-2-3-7(17)15(10(5)12-13-14)11-9(19)8(18)6(4-16)20-11/h2-3,6,8-9,11,16,18-19H,4H2,1H3/t6-,8+,9+,11-/m0/s1 |
| InChIKey | OBWBCADBEBHLQC-QSKNDCFUSA-N |
| XLogP | -2.26 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |