C16H30N2O4 — CID 70580594
(2S,3R)-3-amino-2-(4-cyclohexylbutanoylamino)-2-hydroxy-4-methylpentanoic acid (PubChem CID 70580594) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-(4-cyclohexylbutanoylamino)-2-hydroxy-4-methylpentanoic acid.
| Compound Name | (2S,3R)-3-amino-2-(4-cyclohexylbutanoylamino)-2-hydroxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70580594 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2S,3R)-3-amino-2-(4-cyclohexylbutanoylamino)-2-hydroxy-4-methylpentanoic acid |
| SMILES | CC(C)[C@@H](N)[C@@](O)(NC(=O)CCCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C16H30N2O4/c1-11(2)14(17)16(22,15(20)21)18-13(19)10-6-9-12-7-4-3-5-8-12/h11-12,14,22H,3-10,17H2,1-2H3,(H,18,19)(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | WNTXUWKOVYYLHG-ZBFHGGJFSA-N |
| XLogP | 1.61 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|