C28H46O2 — CID 70580686
2-[(4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]-2-methyl-1,3-dioxolane (PubChem CID 70580686) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is 2-[(4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 70580686 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 2-[(4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]-2-methyl-1,3-dioxolane |
| SMILES | C[C@H](CCCC1(C)OCCO1)[C@H]1CC[C@H]2[C@@H]3CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H46O2/c1-20(8-7-16-28(4)29-18-19-30-28)23-12-13-24-22-11-10-21-9-5-6-15-26(21,2)25(22)14-17-27(23,24)3/h10,20,22-25H,5-9,11-19H2,1-4H3/t20-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | QGHYTHPPLSQEIB-HKQCOZBKSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|