About ethyl (2S)-2-hydroxyhexanoate
ethyl (2S)-2-hydroxyhexanoate (PubChem CID 7058147) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxyhexanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-hydroxyhexanoate |
| PubChem CID | 7058147 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | ethyl (2S)-2-hydroxyhexanoate |
| SMILES | CCCC[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C8H16O3/c1-3-5-6-7(9)8(10)11-4-2/h7,9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | MRYSSTRVUMCKKB-ZETCQYMHSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2S)-2-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-hydroxyhexanoate?
The IUPAC name of ethyl (2S)-2-hydroxyhexanoate (CID 7058147) is ethyl (2S)-2-hydroxyhexanoate.
What is the SMILES notation for ethyl (2S)-2-hydroxyhexanoate?
The canonical SMILES for ethyl (2S)-2-hydroxyhexanoate is CCCC[C@H](O)C(=O)OCC.
What is the InChIKey of ethyl (2S)-2-hydroxyhexanoate?
The InChIKey is MRYSSTRVUMCKKB-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-5-6-7(9)8(10)11-4-2/h7,9H,3-6H2,1-2H3/t7-/m0/s1.
What are the key properties of ethyl (2S)-2-hydroxyhexanoate?
ethyl (2S)-2-hydroxyhexanoate has a molecular weight of 160.21 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-hydroxyhexanoate is sourced from PubChem (CID 7058147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).