C24H32N4O2 — CID 70583070
4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 70583070) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 70583070 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CN(Cc1cccc(-c2ccc(C(=O)NCCN3CCCCC3)cc2)c1)C(=O)CN |
| InChI | InChI=1S/C24H32N4O2/c1-27(23(29)17-25)18-19-6-5-7-22(16-19)20-8-10-21(11-9-20)24(30)26-12-15-28-13-3-2-4-14-28/h5-11,16H,2-4,12-15,17-18,25H2,1H3,(H,26,30) |
| InChIKey | UFVHZTXLMCLZOZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |