C17H24Cl2N2O4 — CID 70584966
[3-[bis(2-chloropropan-2-yl)carbamoyloxy]phenyl]-propan-2-ylcarbamic acid (PubChem CID 70584966) has the molecular formula C17H24Cl2N2O4 and a molecular weight of 391.30 g/mol. Its IUPAC name is [3-[bis(2-chloropropan-2-yl)carbamoyloxy]phenyl]-propan-2-ylcarbamic acid.
| Compound Name | [3-[bis(2-chloropropan-2-yl)carbamoyloxy]phenyl]-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 70584966 |
| Molecular Formula | C17H24Cl2N2O4 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [3-[bis(2-chloropropan-2-yl)carbamoyloxy]phenyl]-propan-2-ylcarbamic acid |
| SMILES | CC(C)N(C(=O)O)c1cccc(OC(=O)N(C(C)(C)Cl)C(C)(C)Cl)c1 |
| InChI | InChI=1S/C17H24Cl2N2O4/c1-11(2)20(14(22)23)12-8-7-9-13(10-12)25-15(24)21(16(3,4)18)17(5,6)19/h7-11H,1-6H3,(H,22,23) |
| InChIKey | MCIOCXSHEJFZKK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|