C28H38O3 — CID 70585382
(8R,9R,10S,13S,14S)-17-but-2-ynyl-10-(cyclopenten-1-yloxymethyl)-17-hydroxy-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70585382) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-but-2-ynyl-10-(cyclopenten-1-yloxymethyl)-17-hydroxy-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-17-but-2-ynyl-10-(cyclopenten-1-yloxymethyl)-17-hydroxy-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70585382 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-but-2-ynyl-10-(cyclopenten-1-yloxymethyl)-17-hydroxy-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC#CCC1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(COC4=CCCC4)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H38O3/c1-3-4-14-28(30)17-13-24-23-10-9-20-18-21(29)11-16-27(20,19-31-22-7-5-6-8-22)25(23)12-15-26(24,28)2/h7,18,23-25,30H,5-6,8-17,19H2,1-2H3/t23-,24-,25+,26-,27+,28?/m0/s1 |
| InChIKey | OKHSNZLVTXDBSC-NJXSKLMRSA-N |
| XLogP | 5.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|