C17H30O — CID 70586341
1,2,3-trimethylcyclotetradeca-2,11-dien-1-ol (PubChem CID 70586341) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1,2,3-trimethylcyclotetradeca-2,11-dien-1-ol.
| Compound Name | 1,2,3-trimethylcyclotetradeca-2,11-dien-1-ol |
|---|---|
| PubChem CID | 70586341 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1,2,3-trimethylcyclotetradeca-2,11-dien-1-ol |
| SMILES | CC1=C(C)C(C)(O)CCC=CCCCCCCC1 |
| InChI | InChI=1S/C17H30O/c1-15-13-11-9-7-5-4-6-8-10-12-14-17(3,18)16(15)2/h8,10,18H,4-7,9,11-14H2,1-3H3 |
| InChIKey | QGCNLKMOJIHQEM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|