C27H38N4O3 — CID 70587116
methyl 3-[benzhydryl(3-piperazin-1-ylpropylcarbamoyl)amino]-3-methylbutanoate (PubChem CID 70587116) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is methyl 3-[benzhydryl(3-piperazin-1-ylpropylcarbamoyl)amino]-3-methylbutanoate.
| Compound Name | methyl 3-[benzhydryl(3-piperazin-1-ylpropylcarbamoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 70587116 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | methyl 3-[benzhydryl(3-piperazin-1-ylpropylcarbamoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)CC(C)(C)N(C(=O)NCCCN1CCNCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H38N4O3/c1-27(2,21-24(32)34-3)31(26(33)29-15-10-18-30-19-16-28-17-20-30)25(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-14,25,28H,10,15-21H2,1-3H3,(H,29,33) |
| InChIKey | KAAJZQFVEMZUSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|