C22H27N5OS — CID 70587308
4-[[2-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethylamino]pyrimidin-5-yl]methyl]-1H-pyridin-2-one (PubChem CID 70587308) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-[[2-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethylamino]pyrimidin-5-yl]methyl]-1H-pyridin-2-one.
| Compound Name | 4-[[2-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethylamino]pyrimidin-5-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 70587308 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[[2-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethylamino]pyrimidin-5-yl]methyl]-1H-pyridin-2-one |
| SMILES | CN(C)Cc1cccc(CSCCNc2ncc(Cc3cc[nH]c(=O)c3)cn2)c1 |
| InChI | InChI=1S/C22H27N5OS/c1-27(2)15-18-4-3-5-19(11-18)16-29-9-8-24-22-25-13-20(14-26-22)10-17-6-7-23-21(28)12-17/h3-7,11-14H,8-10,15-16H2,1-2H3,(H,23,28)(H,24,25,26) |
| InChIKey | YPFBAJTWVYSMFY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|