C19H24N2S2 — CID 12952027
N-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethyl]benzenecarbothioamide (PubChem CID 12952027) has the molecular formula C19H24N2S2 and a molecular weight of 344.55 g/mol. Its IUPAC name is N-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethyl]benzenecarbothioamide.
| Compound Name | N-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 12952027 |
| Molecular Formula | C19H24N2S2 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[2-[[3-[(dimethylamino)methyl]phenyl]methylsulfanyl]ethyl]benzenecarbothioamide |
| SMILES | CN(C)Cc1cccc(CSCCNC(=S)c2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2S2/c1-21(2)14-16-7-6-8-17(13-16)15-23-12-11-20-19(22)18-9-4-3-5-10-18/h3-10,13H,11-12,14-15H2,1-2H3,(H,20,22) |
| InChIKey | SRVDIQUEJSLGBJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|