C28H46N2O4 — CID 70587503
1-(3-cyclohexyl-3-hydroxypropyl)-5-[6-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]hex-2-enyl]imidazolidine-2,4-dione (PubChem CID 70587503) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is 1-(3-cyclohexyl-3-hydroxypropyl)-5-[6-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]hex-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-(3-cyclohexyl-3-hydroxypropyl)-5-[6-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]hex-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70587503 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 1-(3-cyclohexyl-3-hydroxypropyl)-5-[6-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]hex-2-enyl]imidazolidine-2,4-dione |
| SMILES | CC1CCC2C(C)(C)C2(OCCCC=CCC2C(=O)NC(=O)N2CCC(O)C2CCCCC2)C1 |
| InChI | InChI=1S/C28H46N2O4/c1-20-14-15-24-27(2,3)28(24,19-20)34-18-10-5-4-9-13-22-25(32)29-26(33)30(22)17-16-23(31)21-11-7-6-8-12-21/h4,9,20-24,31H,5-8,10-19H2,1-3H3,(H,29,32,33) |
| InChIKey | DPQLINYHCHJJEN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|