C20H37N2O5P — CID 11316009
6-[(4S)-3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]hexyl-ethylphosphinic acid (PubChem CID 11316009) has the molecular formula C20H37N2O5P and a molecular weight of 416.50 g/mol. Its IUPAC name is 6-[(4S)-3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]hexyl-ethylphosphinic acid.
| Compound Name | 6-[(4S)-3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]hexyl-ethylphosphinic acid |
|---|---|
| PubChem CID | 11316009 |
| Molecular Formula | C20H37N2O5P |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 6-[(4S)-3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]hexyl-ethylphosphinic acid |
| SMILES | CCP(=O)(O)CCCCCC[C@H]1C(=O)NC(=O)N1CCC(O)C1CCCCC1 |
| InChI | InChI=1S/C20H37N2O5P/c1-2-28(26,27)15-9-4-3-8-12-17-19(24)21-20(25)22(17)14-13-18(23)16-10-6-5-7-11-16/h16-18,23H,2-15H2,1H3,(H,26,27)(H,21,24,25)/t17-,18?/m0/s1 |
| InChIKey | FPGSHIWUPCMBMZ-ZENAZSQFSA-N |
| XLogP | 3.48 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|