C20H38N2O4 — CID 7058807
ethyl 4-[(2R)-3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazine-1-carboxylate (PubChem CID 7058807) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl 4-[(2R)-3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2R)-3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7058807 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | ethyl 4-[(2R)-3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C[C@@H](O)COC2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H38N2O4/c1-5-25-19(24)22-12-10-21(11-13-22)14-17(23)15-26-18-8-6-16(7-9-18)20(2,3)4/h16-18,23H,5-15H2,1-4H3/t16?,17-,18?/m1/s1 |
| InChIKey | MVHXDCKVSPFTDX-LXPRWKDFSA-N |
| XLogP | 2.74 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |