C22H18Cl3NO3 — CID 70588180
[3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dichloro-3-phenoxycyclopropane-1-carboxylate (PubChem CID 70588180) has the molecular formula C22H18Cl3NO3 and a molecular weight of 450.75 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dichloro-3-phenoxycyclopropane-1-carboxylate.
| Compound Name | [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dichloro-3-phenoxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70588180 |
| Molecular Formula | C22H18Cl3NO3 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dichloro-3-phenoxycyclopropane-1-carboxylate |
| SMILES | O=C(OCn1ccc(Cc2ccc(Cl)cc2)c1)C1C(Oc2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C22H18Cl3NO3/c23-17-8-6-15(7-9-17)12-16-10-11-26(13-16)14-28-21(27)19-20(22(19,24)25)29-18-4-2-1-3-5-18/h1-11,13,19-20H,12,14H2 |
| InChIKey | VWAUEJBSCJTCHG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|