C21H26O4 — CID 70588824
3-[1-(6,6-dihydroxyhexoxy)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 70588824) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[1-(6,6-dihydroxyhexoxy)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[1-(6,6-dihydroxyhexoxy)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 70588824 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-[1-(6,6-dihydroxyhexoxy)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(C=CC1(OCCCCCC(O)O)C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C21H26O4/c22-19(18-10-4-1-5-11-18)13-16-21(14-7-3-8-15-21)25-17-9-2-6-12-20(23)24/h1,3-5,7-8,10-11,13-14,16,20,23-24H,2,6,9,12,15,17H2 |
| InChIKey | WGOTWQQFVGZXNJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|