C7H13NO4S — CID 7058924
3-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate (PubChem CID 7058924) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate.
| Compound Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 7058924 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate |
| SMILES | O=C([O-])CC[NH2+][C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO4S/c9-7(10)1-3-8-6-2-4-13(11,12)5-6/h6,8H,1-5H2,(H,9,10)/t6-/m0/s1 |
| InChIKey | IKVXZBQFTASZSZ-LURJTMIESA-N |
| XLogP | -3.12 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |