About [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate
[(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate (PubChem CID 70589261) has the molecular formula C13H13N3O5S
and a molecular weight of 323.33 g/mol. Its IUPAC name is [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate |
| PubChem CID | 70589261 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate |
| SMILES | CS[C@@]1(N=Cc2ccc([N+](=O)[O-])cc2)C(=O)N[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H13N3O5S/c1-8(17)21-12-13(22-2,11(18)15-12)14-7-9-3-5-10(6-4-9)16(19)20/h3-7,12H,1-2H3,(H,15,18)/t12-,13-/m0/s1 |
| InChIKey | VUJMXJYAECCDLV-STQMWFEESA-N |
| XLogP | 1.09 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate?
The IUPAC name of [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate (CID 70589261) is [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate.
What is the SMILES notation for [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate?
The canonical SMILES for [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate is CS[C@@]1(N=Cc2ccc([N+](=O)[O-])cc2)C(=O)N[C@H]1OC(C)=O.
What is the InChIKey of [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate?
The InChIKey is VUJMXJYAECCDLV-STQMWFEESA-N. The full InChI is InChI=1S/C13H13N3O5S/c1-8(17)21-12-13(22-2,11(18)15-12)14-7-9-3-5-10(6-4-9)16(19)20/h3-7,12H,1-2H3,(H,15,18)/t12-,13-/m0/s1.
What are the key properties of [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate?
[(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate has a molecular weight of 323.33 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate is sourced from PubChem (CID 70589261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).