C13H13N3O5S — CID 70589261
[(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate (PubChem CID 70589261) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 70589261 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [(2S,3R)-3-methylsulfanyl-3-[(4-nitrophenyl)methylideneamino]-4-oxoazetidin-2-yl] acetate |
| SMILES | CS[C@@]1(N=Cc2ccc([N+](=O)[O-])cc2)C(=O)N[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H13N3O5S/c1-8(17)21-12-13(22-2,11(18)15-12)14-7-9-3-5-10(6-4-9)16(19)20/h3-7,12H,1-2H3,(H,15,18)/t12-,13-/m0/s1 |
| InChIKey | VUJMXJYAECCDLV-STQMWFEESA-N |
| XLogP | 1.09 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|