C13H18N2 — CID 7059356
N-(3-methylphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 7059356) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(3-methylphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(3-methylphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 7059356 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(3-methylphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | Cc1cccc(NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C13H18N2/c1-11-6-5-7-12(10-11)15-13-8-3-2-4-9-14-13/h5-7,10H,2-4,8-9H2,1H3,(H,14,15) |
| InChIKey | KVBCIUMSKTZHBZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |