C11H13IN2 — CID 79507899
N-(3-iodophenyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 79507899) has the molecular formula C11H13IN2 and a molecular weight of 300.14 g/mol. Its IUPAC name is N-(3-iodophenyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(3-iodophenyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 79507899 |
| Molecular Formula | C11H13IN2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | N-(3-iodophenyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | Ic1cccc(NC2=NCCCC2)c1 |
| InChI | InChI=1S/C11H13IN2/c12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h3-5,8H,1-2,6-7H2,(H,13,14) |
| InChIKey | YHPCEDRKGWIGLC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|