C11H12ClIN2 — CID 10042547
N-(2-chloro-4-iodophenyl)-2-methyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 10042547) has the molecular formula C11H12ClIN2 and a molecular weight of 334.59 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2-methyl-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(2-chloro-4-iodophenyl)-2-methyl-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 10042547 |
| Molecular Formula | C11H12ClIN2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2-methyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC1CCC(Nc2ccc(I)cc2Cl)=N1 |
| InChI | InChI=1S/C11H12ClIN2/c1-7-2-5-11(14-7)15-10-4-3-8(13)6-9(10)12/h3-4,6-7H,2,5H2,1H3,(H,14,15) |
| InChIKey | KLIBTBNNCGHLPY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|