About ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride
ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride (PubChem CID 70593565) has the molecular formula C9H18Cl2N2O
and a molecular weight of 241.16 g/mol. Its IUPAC name is ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride |
| PubChem CID | 70593565 |
| Molecular Formula | C9H18Cl2N2O |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\OCC)C12CC1CN(C)C2 |
| InChI | InChI=1S/C9H16N2O.2ClH/c1-3-12-8(10)9-4-7(9)5-11(2)6-9;;/h7,10H,3-6H2,1-2H3;2*1H/b10-8-;; |
| InChIKey | OTLSHNPOYOUQDC-GPWRMYTLSA-N |
| XLogP | 1.80 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride?
The IUPAC name of ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride (CID 70593565) is ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride.
What is the SMILES notation for ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride?
The canonical SMILES for ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride is Cl.Cl.[H]/N=C(\OCC)C12CC1CN(C)C2.
What is the InChIKey of ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride?
The InChIKey is OTLSHNPOYOUQDC-GPWRMYTLSA-N. The full InChI is InChI=1S/C9H16N2O.2ClH/c1-3-12-8(10)9-4-7(9)5-11(2)6-9;;/h7,10H,3-6H2,1-2H3;2*1H/b10-8-;;.
What are the key properties of ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride?
ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride has a molecular weight of 241.16 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-3-azabicyclo[3.1.0]hexane-1-carboximidate;dihydrochloride is sourced from PubChem (CID 70593565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).