C10H22Cl2N2O2 — CID 90485290
ethyl 2-(1,4-dimethylpiperazin-2-yl)acetate;dihydrochloride (PubChem CID 90485290) has the molecular formula C10H22Cl2N2O2 and a molecular weight of 273.20 g/mol. Its IUPAC name is ethyl 2-(1,4-dimethylpiperazin-2-yl)acetate;dihydrochloride.
| Compound Name | ethyl 2-(1,4-dimethylpiperazin-2-yl)acetate;dihydrochloride |
|---|---|
| PubChem CID | 90485290 |
| Molecular Formula | C10H22Cl2N2O2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | ethyl 2-(1,4-dimethylpiperazin-2-yl)acetate;dihydrochloride |
| SMILES | CCOC(=O)CC1CN(C)CCN1C.Cl.Cl |
| InChI | InChI=1S/C10H20N2O2.2ClH/c1-4-14-10(13)7-9-8-11(2)5-6-12(9)3;;/h9H,4-8H2,1-3H3;2*1H |
| InChIKey | NAMJQJDRFHDLBI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |