C13H27N3O2 — CID 63896903
butyl 2-[(1,4-dimethylpiperazin-2-yl)methylamino]acetate (PubChem CID 63896903) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is butyl 2-[(1,4-dimethylpiperazin-2-yl)methylamino]acetate.
| Compound Name | butyl 2-[(1,4-dimethylpiperazin-2-yl)methylamino]acetate |
|---|---|
| PubChem CID | 63896903 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | butyl 2-[(1,4-dimethylpiperazin-2-yl)methylamino]acetate |
| SMILES | CCCCOC(=O)CNCC1CN(C)CCN1C |
| InChI | InChI=1S/C13H27N3O2/c1-4-5-8-18-13(17)10-14-9-12-11-15(2)6-7-16(12)3/h12,14H,4-11H2,1-3H3 |
| InChIKey | RQKHOMUTAJSBGL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|