C22H30O4S — CID 70596203
(8R,9S,10S,13S)-10,13-dimethyl-17-(2-methylsulfonylacetyl)-1,2,4,5,6,7,8,9,11,12-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70596203) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is (8R,9S,10S,13S)-10,13-dimethyl-17-(2-methylsulfonylacetyl)-1,2,4,5,6,7,8,9,11,12-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S)-10,13-dimethyl-17-(2-methylsulfonylacetyl)-1,2,4,5,6,7,8,9,11,12-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70596203 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (8R,9S,10S,13S)-10,13-dimethyl-17-(2-methylsulfonylacetyl)-1,2,4,5,6,7,8,9,11,12-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)CC[C@@]43C)C1=CC=C2C(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C22H30O4S/c1-21-10-8-15(23)12-14(21)4-5-16-17-6-7-19(20(24)13-27(3,25)26)22(17,2)11-9-18(16)21/h6-7,14,16,18H,4-5,8-13H2,1-3H3/t14?,16-,18-,21-,22-/m0/s1 |
| InChIKey | AJBONBOHDRBFDP-SYGCQNSHSA-N |
| XLogP | 3.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |