C29H47NO5S — CID 172517497
1-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperidine-4-sulfonic acid (PubChem CID 172517497) has the molecular formula C29H47NO5S and a molecular weight of 521.76 g/mol. Its IUPAC name is 1-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperidine-4-sulfonic acid.
| Compound Name | 1-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperidine-4-sulfonic acid |
|---|---|
| PubChem CID | 172517497 |
| Molecular Formula | C29H47NO5S |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | 1-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperidine-4-sulfonic acid |
| SMILES | C[C@H](CCC(=O)N1CCC(S(=O)(=O)O)CC1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO5S/c1-19(4-9-27(32)30-16-12-22(13-17-30)36(33,34)35)24-7-8-25-23-6-5-20-18-21(31)10-14-28(20,2)26(23)11-15-29(24,25)3/h19-20,22-26H,4-18H2,1-3H3,(H,33,34,35)/t19-,20-,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | XRNPABZPIIYNBC-ATMZHIIDSA-N |
| XLogP | 5.51 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|