C16H20N2O — CID 7059807
3-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 7059807) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 7059807 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | C[C@H]1CCCC[C@@H]1/N=C/C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H20N2O/c1-11-6-2-4-8-14(11)17-10-13-12-7-3-5-9-15(12)18-16(13)19/h3,5,7,9-11,13-14H,2,4,6,8H2,1H3,(H,18,19)/b17-10+/t11-,13?,14-/m0/s1 |
| InChIKey | XVZDPJNSDQCLTP-WSMHOCPVSA-N |
| XLogP | 3.37 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|