C9H11N3O2 — CID 70598921
1-(2-acetyl-4,5-diamino-3-pyridinyl)ethanone (PubChem CID 70598921) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(2-acetyl-4,5-diamino-3-pyridinyl)ethanone.
| Compound Name | 1-(2-acetyl-4,5-diamino-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 70598921 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(2-acetyl-4,5-diamino-3-pyridinyl)ethanone |
| SMILES | CC(=O)c1ncc(N)c(N)c1C(C)=O |
| InChI | InChI=1S/C9H11N3O2/c1-4(13)7-8(11)6(10)3-12-9(7)5(2)14/h3H,10H2,1-2H3,(H2,11,12) |
| InChIKey | NYMBENQEYRBIMW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |