C19H30N2O6 — CID 70598935
ethyl 2-(2-aminoacetyl)oxypropanoate;(2S)-2-(2-propan-2-ylanilino)propanoic acid (PubChem CID 70598935) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 2-(2-aminoacetyl)oxypropanoate;(2S)-2-(2-propan-2-ylanilino)propanoic acid.
| Compound Name | ethyl 2-(2-aminoacetyl)oxypropanoate;(2S)-2-(2-propan-2-ylanilino)propanoic acid |
|---|---|
| PubChem CID | 70598935 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl 2-(2-aminoacetyl)oxypropanoate;(2S)-2-(2-propan-2-ylanilino)propanoic acid |
| SMILES | CC(C)c1ccccc1N[C@@H](C)C(=O)O.CCOC(=O)C(C)OC(=O)CN |
| InChI | InChI=1S/C12H17NO2.C7H13NO4/c1-8(2)10-6-4-5-7-11(10)13-9(3)12(14)15;1-3-11-7(10)5(2)12-6(9)4-8/h4-9,13H,1-3H3,(H,14,15);5H,3-4,8H2,1-2H3/t9-;/m0./s1 |
| InChIKey | GQCRELOVAMLOMW-FVGYRXGTSA-N |
| XLogP | 2.13 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |