C24H32O5 — CID 70599440
[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] 2-hydroxypropanoate (PubChem CID 70599440) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] 2-hydroxypropanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 70599440 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] 2-hydroxypropanoate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C(OC(=O)C(C)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H32O5/c1-13(25)18-7-8-19-17-6-5-15-11-16(27)12-21(29-22(28)14(2)26)24(15,4)20(17)9-10-23(18,19)3/h11-12,14,17-20,26H,5-10H2,1-4H3/t14?,17-,18+,19-,20-,23+,24-/m0/s1 |
| InChIKey | NTERCXQNXKFBIF-JNBBHGQDSA-N |
| XLogP | 3.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |