C40H44O8Si2 — CID 70600987
methyl 4-[[4-[[ethenyl(dimethyl)silyl]methoxycarbonyl]phenyl]-[5-[[ethenyl(dimethyl)silyl]methoxy]-2-(4-methoxycarbonylphenoxy)phenyl]methyl]benzoate (PubChem CID 70600987) has the molecular formula C40H44O8Si2 and a molecular weight of 708.96 g/mol. Its IUPAC name is methyl 4-[[4-[[ethenyl(dimethyl)silyl]methoxycarbonyl]phenyl]-[5-[[ethenyl(dimethyl)silyl]methoxy]-2-(4-methoxycarbonylphenoxy)phenyl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[[ethenyl(dimethyl)silyl]methoxycarbonyl]phenyl]-[5-[[ethenyl(dimethyl)silyl]methoxy]-2-(4-methoxycarbonylphenoxy)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 70600987 |
| Molecular Formula | C40H44O8Si2 |
| Molecular Weight | 708.96 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | methyl 4-[[4-[[ethenyl(dimethyl)silyl]methoxycarbonyl]phenyl]-[5-[[ethenyl(dimethyl)silyl]methoxy]-2-(4-methoxycarbonylphenoxy)phenyl]methyl]benzoate |
| SMILES | C=C[Si](C)(C)COC(=O)c1ccc(C(c2ccc(C(=O)OC)cc2)c2cc(OC[Si](C)(C)C=C)ccc2Oc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C40H44O8Si2/c1-9-49(5,6)26-46-34-23-24-36(48-33-21-19-31(20-22-33)39(42)45-4)35(25-34)37(28-11-15-30(16-12-28)38(41)44-3)29-13-17-32(18-14-29)40(43)47-27-50(7,8)10-2/h9-25,37H,1-2,26-27H2,3-8H3 |
| InChIKey | IKXIZEPUKBOZPT-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.96 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|