C19H24O4 — CID 70602135
2-[1-(2-hydroxyethoxy)-1,2-diphenylpropoxy]ethanol (PubChem CID 70602135) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethoxy)-1,2-diphenylpropoxy]ethanol.
| Compound Name | 2-[1-(2-hydroxyethoxy)-1,2-diphenylpropoxy]ethanol |
|---|---|
| PubChem CID | 70602135 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[1-(2-hydroxyethoxy)-1,2-diphenylpropoxy]ethanol |
| SMILES | CC(c1ccccc1)C(OCCO)(OCCO)c1ccccc1 |
| InChI | InChI=1S/C19H24O4/c1-16(17-8-4-2-5-9-17)19(22-14-12-20,23-15-13-21)18-10-6-3-7-11-18/h2-11,16,20-21H,12-15H2,1H3 |
| InChIKey | UGOGYQUITDUHGG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|