C24H41NO2 — CID 70602207
1-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]piperidine-2,2-diol (PubChem CID 70602207) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is 1-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]piperidine-2,2-diol.
| Compound Name | 1-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]piperidine-2,2-diol |
|---|---|
| PubChem CID | 70602207 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | 1-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]piperidine-2,2-diol |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](N3CCCCC3(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C24H41NO2/c1-22-13-4-3-7-17(22)8-9-18-19-10-11-21(23(19,2)15-12-20(18)22)25-16-6-5-14-24(25,26)27/h17-21,26-27H,3-16H2,1-2H3/t17-,18+,19+,20+,21+,22+,23+/m1/s1 |
| InChIKey | KMVTWOKJUZWROE-KVWWBZGASA-N |
| XLogP | 4.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|