About 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole
5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole (PubChem CID 70602445) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole |
| PubChem CID | 70602445 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole |
| SMILES | COC(Cc1ccc2c(c1)C(C)(C)CN2)c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-19(2)13-20-17-10-9-14(11-16(17)19)12-18(21-3)15-7-5-4-6-8-15/h4-11,18,20H,12-13H2,1-3H3 |
| InChIKey | KFLLIMAYFAQAPE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole?
The IUPAC name of 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole (CID 70602445) is 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole.
What is the SMILES notation for 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole?
The canonical SMILES for 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole is COC(Cc1ccc2c(c1)C(C)(C)CN2)c1ccccc1.
What is the InChIKey of 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole?
The InChIKey is KFLLIMAYFAQAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c1-19(2)13-20-17-10-9-14(11-16(17)19)12-18(21-3)15-7-5-4-6-8-15/h4-11,18,20H,12-13H2,1-3H3.
What are the key properties of 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole?
5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole has a molecular weight of 281.40 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxy-2-phenylethyl)-3,3-dimethyl-1,2-dihydroindole is sourced from PubChem (CID 70602445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).