C19H23BrN3O4+ — CID 7060329
1-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(4-nitrophenyl)piperazin-1-ium (PubChem CID 7060329) has the molecular formula C19H23BrN3O4+ and a molecular weight of 437.31 g/mol. Its IUPAC name is 1-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(4-nitrophenyl)piperazin-1-ium.
| Compound Name | 1-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(4-nitrophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7060329 |
| Molecular Formula | C19H23BrN3O4+ |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-[(5-bromo-2,4-dimethoxyphenyl)methyl]-4-(4-nitrophenyl)piperazin-1-ium |
| SMILES | COc1cc(OC)c(C[NH+]2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1Br |
| InChI | InChI=1S/C19H22BrN3O4/c1-26-18-12-19(27-2)17(20)11-14(18)13-21-7-9-22(10-8-21)15-3-5-16(6-4-15)23(24)25/h3-6,11-12H,7-10,13H2,1-2H3/p+1 |
| InChIKey | IWLALFYWUCNQDL-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|